Methyl-2-benzoylbenzoate
ALDRICH/559830 - 97%
Synonym: 2-Benzoylbenzoic acid methyl ester; Methyl o-benzoylbenzoate; o-
CAS Number: 606-28-0
Empirical Formula (Hill Notation): C15H12O3
Molecular Weight: 240.25
EC Number: 210-112-3
MDL Number: MFCD00017187
Linear Formula: C6H5COC6H4CO2CH3
Product Type: Chemical
| assay | 97% |
| form | solid |
| functional group | ester |
| ketone | |
| phenyl | |
| InChI | 1S/C15H12O3/c1-18-15(17)1 |
| InChI key | NQSMEZJWJJVYOI-UHFFFAOYSA |
| mp | 48-53 °C (lit.) |
| Quality Level | 100 ![]() |
| SMILES string | COC(=O)c1ccccc1C(=O)c2ccc |
| General description: | Methyl-2-benzoylbenzoate is a 2-acylarylcarboxylate. • It can undergo asymmetric transfer hydrogenation reaction in propanol in the presence of a Ruthenium catalyst. • Methyl-2-benzoylbenzoat • Methyl-2-benzoylbenzoat |
| Packaging: | 25 g in glass bottle |
| Symbol | GHS09 |
| Signal word | Warning |
| Hazard statements | H410 |
| Hazard Codes | N |
| Risk Statements | 50/53 |
| Safety Statements | 60-61 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 97% |
| mp | 48-53 °C (lit.) |
| UNSPSC | 12352100 |


