Synonym: 1-(2-trans-Cyclohexanediol)ethyl-3,5,7,9,11,13,15-isobutylpentacyclo[9.5.1.13,9 .15,15.17,13]octasiloxane; trans-Cyclohexanediolisobutyl-POSS®; POSS®-trans-cyclohexanediol-isobutyl substituted
CAS Number: 480439-48-3
Empirical Formula (Hill Notation): C36H78O14Si8
Molecular Weight: 959.68
Linear Formula: C36H78O14Si8
Product Type: Chemical
| InChI |
1S/C36H78O14Si8/c1-27(2)20-52-39-51(18-17-34-15-16-35(37)36(38)19-34)40-53(21-28(3)4)44-55(42-52,23-30(7)8)48-58(26-33(13)14)49-56(43-52,24-31(9)10)45-54(41-51,22-29(5)6)47-57(46-53,50-58)25-32(11)12/h27-38H,15-26H2,1-14H3 |
| InChI key |
SPLVLZDHFGEUJL-UHFFFAOYSA-N |
| mp |
160 °C (lit.) |
| SMILES string |
CC(C)C[Si]12O[Si]4(CCC3CCC(O)C(O)C3)O[Si]5(CC(C)C)O[Si](CC(C)C)(O1)O[Si]6(CC(C)C)O[Si](CC(C)C)(O2)O[Si](CC(C)C)(O4)O[Si](CC(C)C)(O5)O6 |
| solubility |
acetone: soluble |
| |
acetonitrile: insoluble |
| |
chloroform: soluble |
| |
hexane: soluble |
| |
THF: soluble |
| Legal Information: |
POSS is a registered trademark of Hybrid Plastics, Inc. |
| Packaging: |
5 g in glass bottle |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| mp |
160 °C (lit.) |
| UNSPSC |
12162002 |
