4-Phenoxyphenylmagnesium bromide solution
ALDRICH/561681 - 0.5 M in THF
Synonym: Bromo(4-
CAS Number: 21473-02-9
Empirical Formula (Hill Notation): C12H9BrMgO
Molecular Weight: 273.41
MDL Number: MFCD00672009
Linear Formula: C6H5OC6H4MgBr
Product Type: Chemical
| bp | 65 °C |
| concentration | 0.5 M in THF |
| density | 0.968 g/mL at 25 °C |
| functional group | phenoxy |
| InChI | 1S/C12H9O.BrH.Mg/c1-3-7-1 |
| InChI key | DTIKYZPTJRZFTL-UHFFFAOYSA |
| Quality Level | 100 ![]() |
| reaction suitability | reaction type: Grignard Reaction |
| SMILES string | Br[Mg]c1ccc(Oc2ccccc2)cc1 |
| storage temp. | 2-8°C |
| Legal Information: | Product of Rieke Metals, Inc. Rieke is a registered trademark of Rieke Metals, Inc. |
| Packaging: | 50 mL in Sure/Seal™ |
| Symbol | ![]() GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H319 - H335 - H351 |
| Precautionary statements | P261 - P281 - P305 + P351 + P338 |
| Hazard Codes | Xn |
| Risk Statements | 19-36/37-40 |
| Safety Statements | 26-36/37 |
| RIDADR | UN 2924 8(3) / PGII |
| WGK Germany | WGK 3 |
| Flash Point(F) | -6.2 °F - (THF) |
| Flash Point(C) | -21.2 °C - (THF) |
| Supplemental Hazard Statements | EUH019 |
| bp | 65 °C |
| Density | 0.968 g/mL at 25 °C |
| Storage Temp. | 2-8°C |
| UNSPSC | 12352103 |



