N-(2-Aminoethyl)maleimide trifluoroacetate salt
ALDRICH/56951 - ≥95% (HPLC), ≥98% (T)
Synonym: 2-
CAS Number: 146474-00-2
Empirical Formula (Hill Notation): C6H8N2O2 · C2HF3O2
Molecular Weight: 254.16
MDL Number: MFCD01073617
Linear Formula: C6H8N2O2 · C2HF3O2
Product Type: Chemical
| assay | ≥95% (HPLC) |
| ≥98% (T) | |
| form | powder |
| functional group | amine |
| maleimide | |
| InChI | 1S/C6H8N2O2.C2HF3O2/c7-3- |
| InChI key | YNHKVOGCDPODMT-UHFFFAOYSA |
| polymer architecture | functionality : heterobifunctional |
| reaction suitability | reagent type: cross-linking reagent |
| reagent type: linker | |
| SMILES string | OC(C(F)(F)F)=O.O=C1N(CCN) |
| Application: | N-(2-Aminoethyl)maleimide trifluoroacetate salt commonly utilized:• As a crosslinking agent to form covalent bonds between polymeric precursors • In the synthesis of maleimide-functionalized heparin hydrogels by introducing maleimide functional groups to molecules, enabling subsequent bioconjugation • In the synthesis of N-(2-{3-Iodobenzoyl}amino • As a building block in the synthesis of maleimide-functionalized cymantrenyl derivatives |
| General description: | N-(2-Aminoethyl)maleimide trifluoroacetate salt is a thiol reactive cross-linking agent used in the preparation of heparin hydrogels |
| Other Notes: | Heterobifunctional linker for introducing a maleimide function into the widely used NOSu-modified fluorescent labels. |
| Packaging: | 1 g in poly tube |
| Packaging: | 250 mg in poly bottle |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315 - H319 - H335 |
| Precautionary statements | P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥95% (HPLC); ≥98% (T) |
| UNSPSC | 12161502 |