2-(9H-Carbazol-9-yl)ethyl acrylate
ALDRICH/570362 - 97%
Synonym: 2-(9H-Carbazol-9-yl)ethyl methacrylate; 9H-
CAS Number: 6915-68-0
Empirical Formula (Hill Notation): C17H15NO2
Molecular Weight: 265.31
MDL Number: MFCD00085235
Linear Formula: C17H15NO2
Product Type: Chemical
| assay | 97% |
| InChI | 1S/C17H15NO2/c1-2-17(19)2 |
| InChI key | KOHMQTTZAWPDNE-UHFFFAOYSA |
| mp | 77-81 °C (lit.) |
| Quality Level | 100 ![]() |
| SMILES string | C=CC(=O)OCCn1c2ccccc2c3cc |
| storage temp. | 2-8°C |
| Application: | PCz can be used as a conducting polymer in the fabrication of a variety of devices which include organic light emitting diodes (OLEDs), photovoltaic cells and memory based devices. |
| Features and Benefits: | NLO chromophore |
| General description: | 2-(9H-Carbazol-9-yl)ethyl acrylate (PCz) is an acrylate based conducting polymer with carbazole as electron donating pendant group. It can be used as a charge transporting material as it exhibits high charge carrier mobility and photochemical stability. It also has high thermal and electroluminescent properties that make it useful in organic electronics based application. |
| Packaging: | 1 g in glass bottle |
| Symbol | ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H315 - H319 - H335 - H411 |
| Precautionary statements | P273 - P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | Xi,N |
| Risk Statements | 36/37/38-51/53 |
| Safety Statements | 26-28-61 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | WGK 2 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 97% |
| mp | 77-81 °C (lit.) |
| Storage Temp. | 2-8°C |
| UNSPSC | 12352103 |



