(−)-Isolongifolene
ALDRICH/58924 - ≥98.0% (sum of enantiomers, GC)
Synonym: (1R)
CAS Number: 1135-66-6
Empirical Formula (Hill Notation): C15H24
Molecular Weight: 204.35
EC Number: 214-494-2
MDL Number: MFCD00042616
Linear Formula: C15H24
Product Type: Chemical
| assay | ≥98.0% (sum of enantiomers, GC) |
| bp | 255-256 °C |
| density | 0.930 g/mL at 20 °C (lit.) |
| InChI | 1S/C15H24/c1-13(2)8-5-6-1 |
| InChI key | CQUAYTJDLQBXCQ-NHYWBVRUSA |
| optical activity | [α]20/D −138±2°, c = 1% in ethanol |
| Quality Level | 100  |
| refractive index | n |
| SMILES string | CC1(C)CCC=C2C(C)(C)[C@H]3 |
| Application: | (-)-Isolongifolene may be used in the preparation of (-)-isolongifolenone, a potent insect repellent. |
| General description: | (-)-Isolongifolene is a sesquiterpene that can be found in pine cone and Japanese cedar essential oils. |
| Other Notes: | This (-)-isolongifolene has an enantiomeric purity of 93%; it is thus the highest purity material ever offered commercially; the double bond can be epoxidized |
| Packaging: | 1 mL in glass bottle |
| Symbol |  GHS02 |
| Signal word | Warning |
| Hazard statements | H226 |
| Risk Statements | 10 |
| RIDADR | UN 2319 3 / PGIII |
| WGK Germany | WGK 3 |
| Flash Point(F) | 120.2 °F - closed cup |
| Flash Point(C) | 49 °C - closed cup |
| Purity | ≥98.0% (sum of enantiomers, GC) |
| bp | 255-256 °C |
| Density | 0.930 g/mL at 20 °C (lit.) |
| Refractive Index | n |
| UNSPSC | 12352200 |