(3R)-(−)-3-(1-Methyl-1H-indol-3-yl)butyraldehyde
ALDRICH/591882 - 98%
CAS Number: 405873-05-4
Empirical Formula (Hill Notation): C13H15NO
Molecular Weight: 201.26
MDL Number: MFCD05664285
Linear Formula: C13H15NO
Product Type: Chemical
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material. This image depicts SKU: 591882-1G
| assay | 98% |
| functional group | aldehyde |
| InChI | 1S/C13H15NO/c1-10(7-8-15) |
| InChI key | OQWWHYBHQFZHLP-SNVBAGLBSA |
| mp | 55.5-59.5 °C (lit.) |
| optical activity | [α]20/D -6, c = 1% in chloroform |
| optical purity | ee: 99% (HPLC) |
| Quality Level | 100  |
| SMILES string | C[C@H](CC=O)c1cn(C)c2cccc |
| Application: | (3R)-(−)-3-(1-Methyl-1H-indol-3-yl)butyraldehyde can be used as a substrate in the synthesis of 2-alkyl cyclohexanone intermediates, applicable in the preparation of tricyclic steroid precursors. |
| Packaging: | 1 g in glass bottle |
| Symbol |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301 - H315 - H319 - H335 |
| Precautionary statements | P261 - P301 + P310 - P305 + P351 + P338 |
| Hazard Codes | T |
| Risk Statements | 25-36/37/38 |
| Safety Statements | 26-45 |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 98% |
| mp | 55.5-59.5 °C (lit.) |
| UNSPSC | 12352005 |