Chloroacetic acid-d3
ALDRICH/615404 - 98 atom % D
Synonym: Trideuteriochloroacetic acid
CAS Number: 1796-85-6
Empirical Formula (Hill Notation): C2D3ClO2
Molecular Weight: 97.52
MDL Number: MFCD00143952
Linear Formula: ClCD2CO2D
Product Type: Chemical
| assay | 99% (CP) |
| bp | 189 °C (lit.) |
| density | 1.630 g/mL |
| InChI | 1S/C2H3ClO2/c3-1-2(4)5/h1 |
| InChI key | FOCAUTSVDIKZOP-RIAYTAFFSA |
| isotopic purity | 98 atom % D |
| mass shift | M+3 |
| mp | 60-63 °C (lit.) |
| Quality Level | 200 ![]() |
| SMILES string | [2H]OC(=O)C([2H])([2H])Cl |
| Packaging: | 5 g in glass bottle |
| Packaging: | This product may be available from bulk stock and can be packaged on demand. For information on pricing, availability and packaging, please contact Stable Isotopes Customer Service . |
| Symbol | ![]() ![]() GHS05,GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H301 + H311 - H314 - H330 - H400 |
| Precautionary statements | P260 - P280 - P301 + P310 + P330 - P303 + P361 + P353 - P304 + P340 + P310 - P305 + P351 + P338 |
| Hazard Codes | T,N |
| Risk Statements | 23/24/25-34-50 |
| Safety Statements | 26-36/37/39-45-61-63 |
| RIDADR | UN 1751 8(6.1) / PGII |
| WGK Germany | WGK 3 |
| Flash Point(F) | 258.8 °F - closed cup |
| Flash Point(C) | 126 °C - closed cup |
| Purity | 99% (CP) |
| bp | 189 °C (lit.) |
| mp | 60-63 °C (lit.) |
| Density | 1.630 g/mL |
| UNSPSC | 12352106 |




