Synonym: 1,1′-[1,2-Phenylenebis(methylene)]bis[1,1-bis(1,1-dimethylethyl)phosphine; 1,2-Bis(di-tert-butylphosphino)xylene; 1,2-Bis[(di-tert-butylphosphino)methyl]benzene
CAS Number: 121954-50-5
Empirical Formula (Hill Notation): C24H44P2
Molecular Weight: 394.55
MDL Number: MFCD03094573
Linear Formula: C6H4[CH2P[C(CH3)2]2]
Product Type: Chemical
| form |
solid |
| functional group |
phosphine |
| InChI |
1S/C24H44P2/c1-21(2,3)25(22(4,5)6)17-19-15-13-14-16-20(19)18-26(23(7,8)9)24(10,11)12/h13-16H,17-18H2,1-12H3 |
| InChI key |
SFCNPIUDAIFHRD-UHFFFAOYSA-N |
| Quality Level |
100  |
| reaction suitability |
reaction type: Buchwald-Hartwig Cross Coupling Reaction |
| |
reaction type: Heck Reaction |
| |
reaction type: Hiyama Coupling |
| |
reaction type: Negishi Coupling |
| |
reaction type: Sonogashira Coupling |
| |
reaction type: Stille Coupling |
| |
reaction type: Suzuki-Miyaura Coupling |
| |
reagent type: ligand |
| SMILES string |
CC(C)(C)P(Cc1ccccc1CP(C(C)(C)C)C(C)(C)C)C(C)(C)C |
| Application: |
DTBPMB may be used as a ligand for the palladium-catalyzed hydroesterification of styrene and vinyl acetate to form branched esters in the presence of polymeric sulfonic acids promoters. |
| General description: |
1,2-Bis(di-tert-butylphosphinomethyl)benzene (DTBPMB) is a bidentate phosphine ligand. DTBPMB in combination with Pd2(dba)3 (dba = trans,trans-dibenzylideneacetone) and a sulfonic acid can catalyze the methoxycarbonylation of ethane to form methyl propanoate. |
| Packaging: |
1, 5 g in glass bottle |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |