3-(3,5-Dimethoxybenzyloxy)phenylboronic acid
ALDRICH/635766
Synonym: 3-(3′,5′-Dimethoxybenzyloxy)phenylboronic acid
CAS Number: 870718-09-5
Empirical Formula (Hill Notation): C15H17BO5
Molecular Weight: 288.10
MDL Number: MFCD06200707
Linear Formula: C6H4OCH2C6H3(OCH3)2B(OH)2
Product Type: Chemical
form | solid |
InChI | 1S/C15H17BO5/c1-19-14-6-1 |
InChI key | AJLNRXRMGFVLDN-UHFFFAOYSA |
mp | 100-105 °C (lit.) |
SMILES string | COc1cc(COc2cccc(c2)B(O)O) |
Other Notes: | Contains varying amounts of anhydride |
Packaging: | 1, 5 g in glass bottle |
Symbol | ![]() |
Signal word | Warning |
Hazard statements | H302-H312-H315-H319-H335 |
Precautionary statements | P261-P280-P305 + P351 + P338 |
Hazard Codes | Xn |
Risk Statements | 20/21/22-36/37/38 |
Safety Statements | 26-36/37 |
RIDADR | NONH for all modes of transport |
WGK Germany | 3 |
mp | 100-105 °C (lit.) |
UNSPSC | 12352103 |