Phenylboronic acid pinacol ester
ALDRICH/647098 - 97%
Synonym: (Pinacolboryl)
CAS Number: 24388-23-6
Empirical Formula (Hill Notation): C12H17BO2
Molecular Weight: 204.07
MDL Number: MFCD00966985
Linear Formula: C12H17BO2
Product Type: Chemical
| assay | 97% |
| form | solid |
| InChI | 1S/C12H17BO2/c1-11(2)12(3 |
| InChI key | KKLCYBZPQDOFQK-UHFFFAOYSA |
| mp | 27-31 °C (lit.) |
| Quality Level | 100 ![]() |
| SMILES string | CC1(C)OB(OC1(C)C)c2ccccc2 |
| Application: | Phenylboronic acid pinacol ester can be used: • To prepare sulfinamide derivatives by reacting with diethylaminosulfur trifluoride (DAST) and potassium phenyltrifluoroborate. • As a substrate in the study of Suzuki–Miyaura coupling of various aryl iodides over SiliaCat Pd(0). |
| General description: | Phenylboronic acid, pinacol ester, also known as boronate ester, is generally used in metal-catalyzed C-C bond formation reactions like Suzuki–Miyaura reaction. |
| Packaging: | 5, 10, 50 g in glass bottle |
| Symbol | GHS07 |
| Signal word | Warning |
| Hazard statements | H302 - H315 - H319 - H335 |
| Precautionary statements | P301 + P312 + P330 - P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | 224.6 °F - closed cup |
| Flash Point(C) | 107 °C - closed cup |
| Purity | 97% |
| mp | 27-31 °C (lit.) |
| UNSPSC | 12352103 |


