Synonym: 1,3,4,6-Tetra-O-acetyl-2-O-trifluoromethanesulfonyl-β-D-mannopyranose; Mannose triflate; TATM
CAS Number: 92051-23-5
Empirical Formula (Hill Notation): C15H19F3O12S
Molecular Weight: 480.36
MDL Number: MFCD00012353
Linear Formula: C15H19F3O12S
Product Type: Chemical
| assay |
98% |
| form |
solid |
| InChI |
1S/C15H19F3O12S/c1-6(19)25-5-10-11(26-7(2)20)12(27-8(3)21)13(14(29-10)28-9(4)22)30-31(23,24)15(16,17)18/h10-14H,5H2,1-4H3/t10-,11-,12+,13+,14-/m1/s1 |
| InChI key |
OIBDVHSTOUGZTJ-PEBLQZBPSA-N |
| optical activity |
[α]22/D -16°, c = 1 in chloroform |
| Quality Level |
100  |
| SMILES string |
CC(=O)OC[C@H]1O[C@@H](OC(C)=O)[C@@H](OS(=O)(=O)C(F)(F)F)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| storage temp. |
−20°C |
| Application: |
β-D-Mannopyranose 1,3,4,6-tetra-O-acetate 2-O-trifluoromethanesulfonate can be used as a reactant to synthesize radioiodine-labeled quantum dots, which are used as radiolabeled fluorescence nano-probes for the cell imaging studies. |
| Packaging: |
20, 100 mg in clear glass bottle |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
98% |
| Storage Temp. |
−20°C |
| UNSPSC |
12352201 |