Methoxy(cyclooctadiene)rhodium(I) dimer
ALDRICH/661058
Synonym: [Rh(OMe)(1,5-cod)]2
CAS Number: 12148-72-0
Empirical Formula (Hill Notation): C18H30O2Rh2
Molecular Weight: 484.24
MDL Number: MFCD08457639
Linear Formula: C18H30O2Rh2
Product Type: Chemical
| form | solid |
| InChI | 1S/2C8H12.2CH3O.2Rh/c2*1- |
| InChI key | BDQMDBOKWREKIT-MIXQCLKLSA |
| mp | 192-225 °C |
| Quality Level | 100 ![]() |
| reaction suitability | core: rhodium |
| reagent type: catalyst | |
| SMILES string | CO[Rh].CO[Rh].C1CC=CCCC=C |
| storage temp. | −20°C |
| Application: | Efficient and Selective Catalysts for Asymmetric Synthesis ![]() |
| Application: | Precursor for organorhodium(I) species, catalyst for cascade1,4-addition-aldol reaction, 1,4-addition of alcohols, and hydroformylation |
| Application: | Rhodium catalyst employed in the cyclization of cyano-substituted unsaturated esters in the presence of aryl 9-BBN leading to 5- and 6-membered β-enamino esters. |
| Packaging: | 1 g in glass bottle |
| Packaging: | 250 mg in glass bottle |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| mp | 192-225 °C |
| Storage Temp. | −20°C |
| UNSPSC | 12161600 |

