Hafnium(IV) n-butoxide
ALDRICH/667943
Synonym: n-Butoxy hafnium; Tetrabutoxyhafnium(IV)
CAS Number: 22411-22-9
Empirical Formula (Hill Notation): C16H36HfO4
Molecular Weight: 470.94
MDL Number: MFCD00236545
Linear Formula: C16H36HfO4
Product Type: Chemical
| density | 1.2376 g/mL |
| form | liquid |
| InChI | 1S/4C4H9O.Hf/c4*1-2-3-4-5 |
| InChI key | LTBRWBUKPWVGFA-UHFFFAOYSA |
| Quality Level | 100 ![]() |
| reaction suitability | core: hafnium |
| reagent type: catalyst | |
| SMILES string | CCCCO[Hf](OCCCC)(OCCCC)OC |
| Application: | Hafnium(IV) n-butoxide can be used:• As a sol-gel precursor to synthesize hafnium oxide(HfO2) ultra-thin films with enhanced dielectric properties. • As a transesterification catalyst for the synthesis of poly(butylene succinate) (PBS). • As a precursor to fabricate BaHfO3(Barium hafnate) perovskitenanocrystals for various electronic applications. |
| General description: | Hafnium(IV) n-butoxide is an organometal oxide widely used in the preparation of Hafnium nanomaterials and as a catalyst in polymerization reactions. |
| Packaging: | 5, 25 g in glass bottle |
| Symbol | ![]() ![]() GHS02,GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H226 - H317 - H318 |
| Precautionary statements | P210 - P280 - P302 + P352 - P305 + P351 + P338 + P310 |
| Hazard Codes | Xi |
| Risk Statements | 10-41-43 |
| Safety Statements | 26-36/37/39 |
| RIDADR | UN 1993C 3 / PGIII |
| WGK Germany | WGK 3 |
| Flash Point(F) | 95.0 °F |
| Flash Point(C) | 35 °C |
| Density | 1.2376 g/mL |
| UNSPSC | 12352103 |




