Synonym: (R)-3,3′-Bis(triphenylsilyl)-1,1′-binaphthalene-2,2′-diol
CAS Number: 111822-69-6
Empirical Formula (Hill Notation): C56H42O2Si2
Molecular Weight: 803.10
MDL Number: MFCD09265078
Linear Formula: C56H42O2Si2
Product Type: Chemical
| assay |
96% |
| form |
solid |
| InChI |
1S/C56H42O2Si2/c57-55-51(59(43-25-7-1-8-26-43,44-27-9-2-10-28-44)45-29-11-3-12-30-45)39-41-23-19-21-37-49(41)53(55)54-50-38-22-20-24-42(50)40-52(56(54)58)60(46-31-13-4-14-32-46,47-33-15-5-16-34-47)48-35-17-6-18-36-48/h1-40,57-58H |
| InChI key |
STBZSRVMGWTCOU-UHFFFAOYSA-N |
| mp |
103-145 °C |
| optical activity |
[α]20/D +114°, c = 1 in chloroform |
| Quality Level |
100  |
| SMILES string |
Oc1c(cc2ccccc2c1-c3c(O)c(cc4ccccc34)[Si](c5ccccc5)(c6ccccc6)c7ccccc7)[Si](c8ccccc8)(c9ccccc9)c%10ccccc%10 |
| Application: |
(R)-3,3′-Bis(triphenylsilyl)-1,1′-bi-2-naphthol reacts with trimethylaluminum to form a chiral organoaluminum reagent, which can catalyze the asymmetric Diels-Alder reaction of cyclopentadiene and methyl acrylate to form the corresponding Diels-Alder adduct. |
| Application: |
Precursor to a chiral Bronsted acid (674745) used to catalyze an enantioselective aza Diels-Alder reaction providing bicyclic lactams. Rare earth metal complexes of this chiral binapthol catalyze an intramolecular hydroamination of amino olefins leading to chiral pyrrolidines. |
| Packaging: |
100 mg in clear glass bottle |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
96% |
| mp |
103-145 °C |
| UNSPSC |
12352005 |