5a(R),10b(S)-5a,10b-Dihydro-2-(pentafluorophenyl)-4H,6H-indeno[2,1-b][1,2,4]triazolo[4,3-d][1,4]oxazinium tetrafluoroborate
ALDRICH/674788 - 97%
Synonym: 2-
CAS Number: 872143-57-2
Empirical Formula (Hill Notation): C18H11BF9N3O
Molecular Weight: 467.10
MDL Number: MFCD08457666
Linear Formula: C18H11BF9N3O
Product Type: Chemical
| assay | 97% |
| form | solid |
| functional group | ether |
| fluoro | |
| InChI | 1S/C18H11F5N3O.BF4/c19-12 |
| InChI key | CPCMDOOTVHDRTM-CVJFODCESA |
| mp | 233-237 °C |
| Quality Level | 100 ![]() |
| SMILES string | F[B-](F)(F)F.Fc1c(F)c(F)c |
| storage temp. | 2-8°C |
| Application: | 5a(R),10b(S)-5a,10b-Dihydro-2-(penta • Benzoin reactions of aldehydes and total synthesis of a natural product named isodarparvinol B. • Synthesis of spirocyclic oxindole-dihydropyranones by reacting α-bromo-α,β-unsaturated aldehydes with isatin derivatives. • Synthesis of 1,4-dicarbonyl compounds through intramolecular Stetter reaction. |
| Packaging: | 250 mg in glass bottle |
| Symbol | GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280 - P305 + P351 + P338 - P310 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 1759 8 / PGII |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 97% |
| mp | 233-237 °C |
| Storage Temp. | 2-8°C |
| UNSPSC | 12352005 |


