Synonym: (1S)-3,3′-Bis[3,5-bis(trifluoromethyl)phenyl]1,1′-binaphthalene-2,2′-diol
CAS Number: 849939-13-5
Empirical Formula (Hill Notation): C36H18F12O2
Molecular Weight: 710.51
MDL Number: MFCD08689862
Linear Formula: C36H18F12O2
Product Type: Chemical
| assay |
95% |
| form |
(Powder or Crystals or Solid or Chunks) |
| InChI |
1S/C36H18F12O2/c37-33(38,39)21-9-19(10-22(15-21)34(40,41)42)27-13-17-5-1-3-7-25(17)29(31(27)49)30-26-8-4-2-6-18(26)14-28(32(30)50)20-11-23(35(43,44)45)16-24(12-20)36(46,47)48/h1-16,49-50H |
| InChI key |
PGXMYJSTCAQJBY-UHFFFAOYSA-N |
| mp |
215-219 °C |
| optical activity |
[α]22/D -56°, c = 1 in chloroform |
| Quality Level |
100  |
| SMILES string |
Oc1c(cc2ccccc2c1-c3c(O)c(cc4ccccc34)-c5cc(cc(c5)C(F)(F)F)C(F)(F)F)-c6cc(cc(c6)C(F)(F)F)C(F)(F)F |
| Application: |
(S)-(-)-3-3′-Bis(3,5-bis(trifluoromethyl)phenyl)-1,1′-bi-2-naphthol reacts with tin(IV) chloride to form a Sn(IV) aryloxide Lewis acid, which can catalyze asymmetric Diels-Alder reactions. |
| Packaging: |
100 mg in clear glass bottle |
| Symbol |
 GHS07 |
| Signal word |
Warning |
| Hazard statements |
H319 |
| Precautionary statements |
P305 + P351 + P338 |
| Hazard Codes |
Xi |
| Risk Statements |
36 |
| Safety Statements |
26 |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
95% |
| mp |
215-219 °C |
| UNSPSC |
12352005 |
