N-[(2S)-2-Pyrrolidinylmethyl]-trifluoromethanesulfonamide
ALDRICH/689017 - ≥98.5% (T)
CAS Number: 782495-18-5
Empirical Formula (Hill Notation): C6H11F3N2O2S
Molecular Weight: 232.22
MDL Number: MFCD11656045
Linear Formula: C6H11F3N2O2S
Product Type: Chemical
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material. This image depicts SKU: 689017-500MG.
| assay | ≥98.5% (T) |
| form | powder |
| functional group | amine |
| fluoro | |
| InChI | 1S/C6H11F3N2O2S/c7-6(8,9) |
| InChI key | RIWFUAUXWIEOTK-YFKPBYRVSA |
| optical activity | [α]/D +13±1°, c = 1 in methanol |
| optical purity | ee: ≥98.5% |
| Quality Level | 200  |
| SMILES string | FC(F)(F)S(=O)(=O)NC[C@@H] |
| Packaging: | 100, 500 mg in glass bottle |
| Packaging: | Bottomless glass bottle. Contents are inside inserted fused cone. |
| Symbol |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280 - P305 + P351 + P338 - P310 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3263 8 / PGIII |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥98.5% (T) |
| UNSPSC | 12352005 |