Synonym: (1S)-3,3′-Bis[2,4,6-tris(1-methylethyl)phenyl]-1,1′-binaphthalene-2,2′-diol
CAS Number: 908338-44-3
Empirical Formula (Hill Notation): C50H58O2
Molecular Weight: 690.99
MDL Number: MFCD11045378
Linear Formula: C50H58O2
Product Type: Chemical
| assay |
95% (HPLC) |
| form |
solid |
| InChI |
1S/C50H58O2/c1-27(2)35-23-39(29(5)6)45(40(24-35)30(7)8)43-21-33-17-13-15-19-37(33)47(49(43)51)48-38-20-16-14-18-34(38)22-44(50(48)52)46-41(31(9)10)25-36(28(3)4)26-42(46)32(11)12/h13-32,51-52H,1-12H3 |
| InChI key |
BCAHCEFAVPAFSH-UHFFFAOYSA-N |
| optical purity |
ee: ≥99.0 |
| Quality Level |
100  |
| SMILES string |
CC(C)c1cc(C(C)C)c(c(c1)C(C)C)-c2cc3ccccc3c(c2O)-c4c(O)c(cc5ccccc45)-c6c(cc(cc6C(C)C)C(C)C)C(C)C |
| Application: |
(S)-3,3′-Bis(2,4,6-triisopropylphenyl)-1,1′-bi-2-naphthol can be used as a reactant to prepare BINOL-based chiral N-triflyl thiophosphoramides as chiral Bronsted acid catalysts for the asymmetric synthesis of α-substituted cycloalkanones via enantioselective hydrolysis of alicyclic silyl enol ethers. |
| Packaging: |
100, 500 mg in glass bottle |
| Packaging: |
Bottomless glass bottle. Contents are inside inserted fused cone. |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
95% (HPLC) |
| UNSPSC |
12352005 |
