(S)-RuCl[(p-cymene(BINAP)]Cl
ALDRICH/692972
Synonym: Chloro[(S)-(−)-2,2′-bis(diphenylphosphino)-1,1′−binaphthyl](p-cymene)ruthenium(II) chloride
CAS Number: 130004-33-0
Empirical Formula (Hill Notation): C54H46Cl2P2Ru
Molecular Weight: 928.87
MDL Number: MFCD00134456
Linear Formula: [C54H46ClP2Ru]+Cl-
Product Type: Chemical
| form | powder |
| functional group | phosphine |
| InChI | 1S/C44H32P2.C10H14.2ClH.R |
| InChI key | WNHLGYRPKARUHY-UHFFFAOYSA |
| Quality Level | 100 ![]() |
| SMILES string | Cl[Ru]Cl.CC(C)c1ccc(C)cc1 |
| storage temp. | 2-8°C |
| Application: | Takasago Ligands and Complexes for Asymmetric Reactions ![]() |
| Legal Information: | Sold in collaboration with Takasago for research purposes only. |
| Packaging: | 100, 500 mg in amber glass bottle |
| Symbol | GHS07 |
| Signal word | Warning |
| Hazard statements | H315 - H319 - H335 |
| Precautionary statements | P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Storage Temp. | 2-8°C |
| UNSPSC | 12352005 |


