Synonym: (2,4-Pentanedionato)bis(ethylene)rhodium; Bis(η2-ethene)(2,4-pentanedionato-κO,κO′)rhodium; Bis(ethylene)(2,4-pentanedionato)rhodium; Bis(ethylene)rhodium(I) acetylacetonate; Diethylene(acetylacetonato)rhodium
CAS Number: 12082-47-2
Empirical Formula (Hill Notation): C9H15O2Rh
Molecular Weight: 258.12
EC Number: 235-147-1
MDL Number: MFCD00015354
Linear Formula: C9H15O2Rh
Product Type: Chemical
| assay |
95% |
| form |
solid |
| InChI |
1S/C5H8O2.2C2H4.Rh/c1-4(6)3-5(2)7;2*1-2;/h3,6H,1-2H3;2*1-2H2;/q;;;+1/p-1/b4-3-;;; |
| InChI key |
FLRBEQQDEGBCJS-FGSKAQBVSA-M |
| mp |
141-142 °C |
| Quality Level |
100  |
| reaction suitability |
core: rhodium |
| |
reagent type: catalyst |
| SMILES string |
C=C.C=C.CC(=O)C=C(C)O[Rh] |
| storage temp. |
2-8°C |
| General description: |
Acetylacetonatobis(ethylene)rhodium(I) is a coordination compound commonly used as a precursor to synthesize mononuclear rhodium complexes. In addition, it is also used as a catalyst in asymmetric arylation reactions. |
| Packaging: |
1 g in glass bottle |
| Packaging: |
250 mg in glass bottle |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
95% |
| mp |
141-142 °C |
| Storage Temp. |
2-8°C |
| UNSPSC |
12161600 |