p-Terphenyl-4,4′′-dithiol
ALDRICH/704709 - 95%
Synonym: 1,4-
CAS Number: 174706-21-9
Empirical Formula (Hill Notation): C18H14S2
Molecular Weight: 294.43
MDL Number: MFCD15144761
Linear Formula: HSC6H4C6H4C6H4SH
Product Type: Chemical
| assay | 95% |
| form | solid |
| InChI | 1S/C18H14S2/c19-17-9-5-15 |
| InChI key | HSAKNFPXLQYFIJ-UHFFFAOYSA |
| mp | 294-299 °C |
| Quality Level | 100 ![]() |
| SMILES string | Sc1ccc(cc1)-c2ccc(cc2)-c3 |
| storage temp. | −20°C |
| Application: | TPDT forms a SAM on gold nanoparticle by immobilizing the surface atoms, which can be used in opto-electronic and other energy based applications. |
| General description: | p-Terphenyl-4,4″ -dithiol (TPDT) is an alkanethiol that forms a self-assembled monolayer (SAM) on a variety of substrates. It can be used to form a dithiol ligand that functionalizes and modifies the properties of surfaces. |
| Packaging: | 1 g in glass bottle |
| Symbol | ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302 - H319 - H410 |
| Precautionary statements | P273 - P301 + P312 + P330 - P305 + P351 + P338 |
| Hazard Codes | Xn,N |
| Risk Statements | 22-50/53 |
| Safety Statements | 60-61 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 95% |
| mp | 294-299 °C |
| Storage Temp. | −20°C |
| UNSPSC | 12352103 |



