1-Butyl-2,3-dimethylimidazolium tetrafluoroborate
ALDRICH/70863 - ≥97.0%
Synonym: [BDMIM][BF4]
CAS Number: 402846-78-0
Empirical Formula (Hill Notation): C9H17BF4N2
Molecular Weight: 240.05
MDL Number: MFCD03427618
Linear Formula: C9H17BF4N2
Product Type: Chemical
| assay | ≥97.0% |
| density | 1.198 g/mL at 20 °C (lit.) |
| form | liquid |
| impurities | ≤1% water |
| InChI | 1S/C9H17N2.BF4/c1-4-5-6-1 |
| InChI key | VCAIYEJBOWHUGP-UHFFFAOYSA |
| mp | 37 °C |
| Quality Level | 100 ![]() |
| SMILES string | F[B-](F)(F)F.CCCCn1cc[n+] |
| Application: | [bdmim]BF4 can be used as a solvent when lipase needs to be recycled during lipase-catalyzed transesterification with vinyl acetate as acyl donor. The [bdmim]BF4/toluene biphasic solvent forms an efficient system for the Negishi cross-coupling reaction between aryl zinc halides and aryl iodides. |
| General description: | 1-Butyl-2,3-dimethylimida |
| Other Notes: | Ionic liquid, suitable for use in strongly basic conditions, for aldol condensations |
| Packaging: | 5, 50 g in poly bottle |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥97.0% |
| mp | 37 °C; 37 °C |
| Density | 1.198 g/mL at 20 °C (lit.) |
| UNSPSC | 12352100 |

