Synonym: (1S,4S,8S) Carreira DOLEFIN Ligand; (1S,4S,8S)--5-Benzyl-8-methoxy-1,8-dimethyl-2-(2′-methylpropyl)-bicyclo[2.2.2]octa-2,5-diene; (1S,4S,8S)-5-Benzyl-2-isobutyl-8-methoxy-1,8-dimethyl-2-bicyclo[2.2.2]octa-2,5-diene
CAS Number: 862499-50-1
Empirical Formula (Hill Notation): C22H30O
Molecular Weight: 310.47
MDL Number: MFCD09265063
Linear Formula: C22H30O
Product Type: Chemical
| assay |
97% |
| form |
liquid |
| functional group |
ether |
| |
phenyl |
| InChI |
1S/C22H30O/c1-16(2)11-19-13-20-18(12-17-9-7-6-8-10-17)14-21(19,3)15-22(20,4)23-5/h6-10,13-14,16,20H,11-12,15H2,1-5H3/t20-,21+,22-/m0/s1 |
| InChI key |
ACWLDJOHMGJACE-BDTNDASRSA-N |
| optical activity |
[α]/D −84±5°, c = 0.5 in chloroform |
| Quality Level |
100  |
| reaction suitability |
reaction type: click chemistry |
| refractive index |
n20/D 1.522 |
| SMILES string |
CO[C@@]1(C)C[C@@]2(C)C=C(Cc3ccccc3)[C@@H]1C=C2CC(C)C |
| Application: |
(1S,4S,8S)-5-Benzyl-2-isobutyl-8-methoxy-1,8-dimethylbicyclo[2.2.2]octa-2,5-diene is mainly useful for the stereoselective synthesis of diarylmethine stereogenic centers. |
| Application: |
Carreira DOLEFIN Ligands |
| General description: |
(1S,4S,8S)-5-Benzyl-2-isobutyl-8-methoxy-1,8-dimethylbicyclo[2.2.2]octa-2,5-diene, an enantiopure diene ligand developed by Carreira, is most commonly used in asymmetric catalysis. It is generally prepared from commercially available (R)-carvone. |
| Packaging: |
100 mg in clear glass bottle |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
97% |
| Refractive Index |
n20/D 1.522 |
| UNSPSC |
12352112 |
