1-Butyl-3-methylimidazolium tetrafluoroborate
ALDRICH/711748 - ≥98%
Synonym: BMIMBF4
CAS Number: 174501-65-6
Empirical Formula (Hill Notation): C8H15BF4N2
Molecular Weight: 226.02
MDL Number: MFCD03095449
Linear Formula: C8H15BF4N2
Product Type: Chemical
| assay | ≥98% |
| density | 1.21 g/mL at 20 °C (lit.) |
| form | liquid |
| impurities | ≤0.5% water |
| InChI | 1S/C8H15N2.BF4/c1-3-4-5-1 |
| InChI key | LSBXQLQATZTAPE-UHFFFAOYSA |
| Quality Level | 100 ![]() |
| SMILES string | F[B-](F)(F)F.CCCCn1cc[n+] |
| Application: | 1-Butyl-3-methylimidazoli • As a reaction medium for the preparation NH4TiOF3 mesocrystals, which are converted into TiO2 based nanostructures. • As a working fluid along with 2,2,2-trifluoroethanol in absorption heat pumps or chillers. • As an electrolyte in lithium-ion batteries and double layer capacitors. |
| General description: | 1-Butyl-3-methylimidazoli |
| Packaging: | 1 kg in glass bottle |
| Packaging: | 100 g in glass bottle |
| Symbol | ![]() GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H301 - H315 - H319 - H411 |
| Precautionary statements | P273 - P301 + P310 + P330 - P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | T,N |
| Risk Statements | 25-36/38-51/53 |
| Safety Statements | 26-45-61 |
| RIDADR | UN2810 - class 6.1 - PG 3 - EHS - Toxic, liquids, organic, n.o.s |
| WGK Germany | WGK 3 |
| Flash Point(F) | 550.4 °F |
| Flash Point(C) | 288 °C |
| Purity | ≥98% |
| Density | 1.21 g/mL at 20 °C (lit.) |
| UNSPSC | 12352100 |



