Fmoc-β-azido-Ala-OH
ALDRICH/714151 - ≥98.0% (HPLC)
Synonym: (S)
CAS Number: 684270-46-0
Empirical Formula (Hill Notation): C18H16N4O4
Molecular Weight: 352.34
MDL Number: MFCD11052919
Linear Formula: C18H16N4O4
Product Type: Chemical
| application(s) | peptide synthesis |
| assay | ≥98.0% (HPLC) |
| form | lumps |
| functional group | Fmoc |
| impurities | 15.3-16.5% nitrogen |
| 60.1-62.5% carbon | |
| InChI | 1S/C18H16N4O4/c19-22-20-9 |
| InChI key | ZITYCUDVCWLHPG-INIZCTEOSA |
| optical activity | [α]/D -10.0±1.0°, c = 1 in DMF |
| reaction suitability | reaction type: click chemistry |
| reaction type: Fmoc solid-phase peptide synthesis | |
| SMILES string | OC(=O)[C@H](CN=[N+]=[N-]) |
| storage temp. | 2-8°C |
| Application: | Fmoc-β-azido-Ala-OH chloride is a general N-terminal protected reagent used in the solid phase peptide synthesis. Azido group allows it to undergo copper-mediated click chemistry reactions. It can be used in: • Synthesis of α-N-acetylgalactosamine (α-GalNAc) linked antifreeze glycopeptides (AFGPs). • Synthesis of stimuli-responsive multifunctional peptide gatekeepers for drug delivery applications. • Synthesis of triazole-linked glycopeptides via Cu(I)-catalyzed 1,3-dipolar cycloaddition (CuAAC). |
| Packaging: | 250 mg in glass bottle |
| Packaging: | Bottomless glass bottle. Contents are inside inserted fused cone. |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥98.0% (HPLC) |
| Storage Temp. | 2-8°C |
| UNSPSC | 12352209 |