2-(Tributylstannyl)pyrimidine
ALDRICH/721174 - 95%
Synonym: 2-
CAS Number: 153435-63-3
Empirical Formula (Hill Notation): C16H30N2Sn
Molecular Weight: 369.13
MDL Number: MFCD01319085
Linear Formula: C16H30N2Sn
Product Type: Chemical
| assay | 95% |
| density | 1.164 g/mL at 25 °C |
| form | liquid |
| InChI | 1S/C4H3N2.3C4H9.Sn/c1-2-5 |
| InChI key | WTFFOOAJSDVASL-UHFFFAOYSA |
| Quality Level | 100 ![]() |
| refractive index | n |
| SMILES string | CCCC[Sn](CCCC)(CCCC)c1ncc |
| Application: | 2-(Tributylstannyl)pyrimi It can also be used in the preparation of various (2-pyrimidyl)silanes. |
| Packaging: | 1, 5 g in glass bottle |
| Symbol | ![]() ![]() GHS06,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H301 - H312 - H315 - H319 - H372 - H410 |
| Precautionary statements | P273 - P280 - P301 + P310 + P330 - P302 + P352 + P312 - P305 + P351 + P338 - P314 |
| Hazard Codes | T,N |
| Risk Statements | 21-25-36/38-48/23/25-50/53 |
| Safety Statements | 36/37/39-45-60-61 |
| RIDADR | UN 2788 6.1 / PGIII |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 95% |
| Density | 1.164 g/mL at 25 °C |
| Refractive Index | n |
| UNSPSC | 12352103 |




