Bis(thiobenzoyl) disulfide
ALDRICH/723118 - >95% (HPLC)
CAS Number: 5873-93-8
Empirical Formula (Hill Notation): C14H10S4
Molecular Weight: 306.49
MDL Number: MFCD12911774
Linear Formula: C14H10S4
Product Type: Chemical
| assay | >95% (HPLC) |
| form | solid |
| InChI | 1S/C14H10S4/c15-13(11-7-3 |
| InChI key | LWGLGSPYKZTZBM-UHFFFAOYSA |
| mp | 94-96 °C |
| Quality Level | 100 ![]() |
| SMILES string | S=C(SSC(=S)c1ccccc1)c2ccc |
| storage temp. | −20°C |
| Application: | Reversible Addition Fragmentation Chain Transfer (RAFT) Polymerization ![]() |
| General description: | Need help choosing the correct RAFT Agent? Please consult the RAFT Agent to Monomer compatibility table. ![]() |
| Packaging: | 5 g in glass bottle |
| Symbol | GHS09 |
| Signal word | Warning |
| Hazard statements | H410 |
| Precautionary statements | P273 |
| Hazard Codes | N |
| Risk Statements | 50/53 |
| Safety Statements | 60-61 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | WGK 2 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | >95% (HPLC) |
| mp | 94-96 °C |
| Storage Temp. | −20°C |
| UNSPSC | 12352100 |


