Poly(ethylene glycol) dimethacrylate
ALDRICH/725684 - average Mn 10,000, contains MEHQ as inhibitor
Synonym: Polyethylene glycol; PEG dimethacrylate
CAS Number: 25852-47-5
MDL Number: MFCD00081877
Linear Formula: C3H5C(O)(OCH2CH2)nOC(O)C3H5
Product Type: Chemical
| Ω-end | methacrylate |
| α-end | methacrylate |
| bp | >200 °C/2 mmHg (lit.) |
| contains | MEHQ as inhibitor |
| ≤1,500 ppm MEHQ as inhibitor (may contain) | |
| form | powder |
| InChI | 1S/C10H14O4/c1-7(2)9(11)1 |
| InChI key | STVZJERGLQHEKB-UHFFFAOYSA |
| Mw/Mn | ≤1.1 |
| mol wt | average Mn 10,000 |
| polymer architecture | shape : linear functionality : homobifunctional |
| reaction suitability | reagent type: cross-linking reagent reaction type: Polymerization Reactions |
| SMILES string | OCCO.CC(=C)C(O)=O |
| storage temp. | −20°C |
| transition temp | Tm 56-61 °C |
| Packaging: | 1 g in glass bottle |
| Preparation Note: | Synthesized with an initial concentration of ≤1,500 ppm MEHQ |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 1 |
| bp | >200 °C/2 mmHg (lit.) |
| Storage Temp. | −20°C |
| UNSPSC | 12162002 |
