Poly(ethylene glycol) diacrylate
ALDRICH/729086 - average Mn 1,000, contains MEHQ as inhibitor
Synonym: Polyethylene glycol; PEG diacrylate
CAS Number: 26570-48-9
MDL Number: MFCD00081876
Product Type: Chemical
| Ω-end | acrylate |
| α-end | acrylate |
| composition | C2H3C(O)(OC2H4)nOC(O)C2H3 |
| contains | MEHQ as inhibitor |
| ≤1,500 ppm MEHQ as inhibitor (may contain) | |
| form | solid |
| InChI | 1S/C8H10O4/c1-3-7(9)11-5- |
| InChI key | KUDUQBURMYMBIJ-UHFFFAOYSA |
| Mw/Mn | ≤1.1 |
| mol wt | average Mn 1,000 |
| polymer architecture | shape : linear functionality : homobifunctional |
| Quality Level | 100 ![]() |
| reaction suitability | reagent type: cross-linking reagent reaction type: Polymerization Reactions |
| SMILES string | OCCO.OC(=O)C=C |
| storage temp. | −20°C |
| transition temp | Tm 32-37 °C |
| Application: | PEGDA has a wide range of usage potentially ranging from tissue engineering, photonics and other biological applications. |
| General description: | Poly(ethylene glycol) diacrylate (PEGDA) is a polyethylene glycol (PEG) based material that is used as a prepolymer solution that can be used in the formation of a cross-linked polymeric system. |
| Packaging: | 1 g in glass bottle |
| Preparation Note: | Synthesized with an initial concentration of ≤1,500 ppm MEHQ |
| Symbol | ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H315 - H317 - H318 |
| Precautionary statements | P261 - P264 - P272 - P280 - P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 38-41-43 |
| Safety Statements | 26-36/37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 1 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Storage Temp. | −20°C |
| UNSPSC | 12162002 |



