Methacrylic acid N-hydroxysuccinimide ester
ALDRICH/730300 - 98%
Synonym: N-
CAS Number: 38862-25-8
Empirical Formula (Hill Notation): C8H9NO4
Molecular Weight: 183.16
MDL Number: MFCD15072193
Linear Formula: C8H9NO4
Product Type: Chemical
| assay | 98% |
| form | solid |
| InChI | 1S/C8H9NO4/c1-5(2)8(12)13 |
| InChI key | ACGJEMXWUYWELU-UHFFFAOYSA |
| mp | 101-105 °C |
| SMILES string | CC(=C)C(=O)ON1C(=O)CCC1=O |
| storage temp. | 2-8°C |
| Application: | Methacrylic acid N-hydroxysuccinimide ester can be used:• As a monomer to prepare degradable amphiphilic diblock copolymer microparticles via RAFT polymerization, for low pH-triggered drug delivery. NHS-MA can shield the drug molecule from degradation, enhance its solubility, and improve its pharmacokinetic properties. • For the surface functionalization of poly-ε-caprolactone (PCL) scaffolds used for tissue engineering. NHS groups are used to couple with chitosan of various molecular weights. • To prepare biocompatible polymer hydrogel for enzymatic biofuel cells. The hydrogel can serve as an enzyme-immobilizing matrix for enzymatic bioelectrodes. |
| General description: | Methacrylic acid N-hydroxysuccinimide ester(NHS-MA) belongs to the class of reactive monomers known as N-hydroxysuccinimide (NHS) esters. It is commonly used for functionalizing biomolecules through amine-reactive coupling reactions infields such as bioconjugation, protein labeling, and peptide synthesis. It also serves as a crosslinking agent or linker molecule for the conjugation of drugs or targeting ligands to carrier materials. |
| Packaging: | 1, 5 g in glass bottle |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 + H332 - H315 - H317 - H319 - H335 |
| Precautionary statements | P261 - P280 - P301 + P312 - P302 + P352 - P304 + P340 + P312 - P305 + P351 + P338 |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-43-48/20/22 |
| Safety Statements | 26-36/37-45 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 98% |
| mp | 101-105 °C |
| Storage Temp. | 2-8°C |
| UNSPSC | 12162002 |