1-Butyl-4-methylpyridinium tetrafluoroborate
ALDRICH/73261 - ≥97.0% (T)
Synonym: 1-Butyl-4-picolinium tetrafluoroborate; 4MBPBF4
CAS Number: 343952-33-0
Empirical Formula (Hill Notation): C10H16BF4N
Molecular Weight: 237.05
MDL Number: MFCD03095460
Linear Formula: C10H16BF4N
Product Type: Chemical
| assay | ≥97.0% (T) |
| density | 1.20 g/mL at 20 °C (lit.) |
| form | liquid |
| InChI | 1S/C10H16N.BF4/c1-3-4-7-1 |
| InChI key | VISYYHYJMCAKAF-UHFFFAOYSA |
| refractive index | n |
| SMILES string | F[B-](F)(F)F.CCCC[n+]1ccc |
| Application: | 4MBPBF4 has been used in the preparation of the SWNT-polymer composite films to improve the dispersion of SWNTs and conductivity of the composites (SWNT= singlewalled carbon nanotubes). The use of 4MBPBF4 as a reaction media during derivatization of dimethyl sulfate with dibenzazepine, accelerates the rate of the reaction. It can also be used to modify carbon paste electrode, which leads to high sensitivity, selectivity and low detection limit for both potassium ferricyanide and dopamine by cyclic voltammetric technique. |
| General description: | Pyridinium based ionic liquid |
| Other Notes: | Lipase catalyzed kinetic resolution in ionic liquids with improved enantioselectivity |
| Packaging: | 5, 50 g in glass bottle |
| Hazard Codes | Xn |
| Risk Statements | 22-36/38 |
| Safety Statements | 26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥97.0% (T) |
| Density | 1.20 g/mL at 20 °C (lit.) |
| Refractive Index | n |
| UNSPSC | 12352100 |