Bis[2-(2-bromoisobutyryloxy)undecyl] disulfide
ALDRICH/733350 - 97%
Synonym: 11,11′-Dithiobis[1-(2-bromo-2-methylpropionyloxy)undecane]; DTBU
CAS Number: 402828-41-5
Empirical Formula (Hill Notation): C30H56Br2O4S2
Molecular Weight: 704.70
MDL Number: MFCD29074053
Linear Formula: C30H56Br2O4S2
Product Type: Chemical
| assay | 97% |
| density | 1.177 g/mL at 25 °C |
| form | solid |
| InChI | 1S/C30H56Br2O4S2/c1-29(2, |
| InChI key | IEGYEGYUHSQEAZ-UHFFFAOYSA |
| Quality Level | 100 ![]() |
| SMILES string | CC(C)(Br)C(=O)OCCCCCCCCCC |
| solubility | 1.500 at 20 °C |
| Application: | Atom transfer Radical Polymerisation (ATRP) initiator commonly used to functionalize noble metal surfaces, and in the preparation of polymer brushes and biodegradable hydrogels. Also may be used to introduce a temperature and light sensitive cleavable region into the polymer. |
| Packaging: | 500 mg in glass insert |
| Symbol | GHS07 |
| Signal word | Warning |
| Hazard statements | H315 - H319 - H335 |
| Precautionary statements | P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 97% |
| Density | 1.177 g/mL at 25 °C |
| UNSPSC | 12162002 |


