25-Hydroxyvitamin D3 (6,19,19-d3) solution
ALDRICH/739618 - 50 μg/mL in ethanol, 97 atom % D, 98% (CP)
Synonym: 25-
CAS Number: 140710-94-7
Empirical Formula (Hill Notation): C27D3H41O2
Molecular Weight: 403.66
EC Number: 200-578-6
MDL Number: MFCD11656128
Linear Formula: C27D3H41O2
Product Type: Chemical
| application(s) | detection |
| assay | 98% (CP) |
| color | colorless |
| concentration | 50 μg/mL in ethanol |
| form | liquid |
| InChI | 1S/C27H44O2/c1-19-10-13-2 |
| InChI key | JWUBBDSIWDLEOM-CMMPNOGOSA |
| isotopic purity | 97 atom % D |
| mass shift | M+3 |
| Quality Level | 200 ![]() |
| SMILES string | [2H]/C([2H])=C1CC[C@H](O) |
| storage temp. | −20°C |
| technique(s) | mass spectrometry (MS): suitable |
| Application: | 25-Hydroxyvitamin D3 (6,19,19-d3) can be used as an analytical standard. |
| General description: | 25-hydroxyvitamin D3 (calcifediol) is a prohormone produced via hydroxylation of vitamin D3 (cholecalciferol) in the liver. It is a precursor for the synthesis of calcitriol or 1,25-dihydroxyvitamin D3 or [1,25(OH)2D3]. It is used as a biomarker to determine the status of vitamin D in the body. 25-Hydroxyvitamin D3 (6,19,19-d3) is a deuterated 25-hydroxyvitamin D3 wherein C-6 and C-19 protons are replaced by deuterium. |
| Packaging: | 1 mL in ampule |
| Symbol | ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225 - H319 |
| Precautionary statements | P210 - P305 + P351 + P338 |
| Hazard Codes | F |
| Risk Statements | 11 |
| Safety Statements | 7-16 |
| RIDADR | UN1170 - class 3 - PG 2 - Ethanol, solution |
| WGK Germany | WGK 1 |
| Flash Point(F) | 57.2 °F - closed cup |
| Flash Point(C) | 14.0 °C - closed cup |
| Purity | 98% (CP) |
| Storage Temp. | −20°C |
| UNSPSC | 12352106 |



