Vitamin D2 (6,19,19-d3) solution
ALDRICH/739839 - 1 mg/mL in ethanol, 97 atom % D, 98% (CP)
Synonym: Calciferol (6,19,19-d3) solution; Ercalciol (6,19,19-d3) solution; Ergocalciferol (6,19,19-d3) solution
Empirical Formula (Hill Notation): C28D3H41O
Molecular Weight: 399.67
MDL Number: MFCD11656674
Linear Formula: C28D3H41O
Product Type: Chemical
| application(s) | detection |
| assay | 98% (CP) |
| color | colorless |
| concentration | 1 mg/mL in ethanol |
| form | solution |
| InChI | 1S/C28H44O/c1-19(2)20(3)9 |
| InChI key | MECHNRXZTMCUDQ-OQGZBSKRSA |
| isotopic purity | 97 atom % D |
| mass shift | M+3 |
| SMILES string | [2H]/C([2H])=C1CC[C@H](O) |
| storage temp. | −20°C |
| technique(s) | mass spectrometry (MS): suitable |
| Application: | Vitamin D2 (6,19,19-d3) can be used as an analytical standard for the quantitative analysis of vitamin D2 concentration in human blood via LC-MS/MS. |
| General description: | Vitamin D2 is also known as ergocalciferol. It is produced by plants and mushrooms when exposed to sunlight. Vitamin D2 (6,19,19-d3) or ergocalciferol (6,19,19-d3) is a deuterated vitamin D2 wherein C-6 and C-19 protons are replaced by deuterium. |
| Packaging: | 1 mL in ampule |
| Symbol |   GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225 - H319 |
| Precautionary statements | P210 - P305 + P351 + P338 |
| Hazard Codes | F,Xn |
| Risk Statements | 11-20 |
| Safety Statements | 16 |
| RIDADR | UN1170 - class 3 - PG 2 - Ethanol, solution |
| WGK Germany | WGK 1 |
| Flash Point(F) | 57.2 °F |
| Flash Point(C) | 14 °C |
| Purity | 98% (CP) |
| Storage Temp. | −20°C |
| UNSPSC | 12352106 |