Synonym: 25-(2,5-Dihydro-2,5-dioxo-1H-pyrrol-1-yl)-23-oxo-4,7,10,13,16,19-hexaoxa-22-azapentacosanoic acid 2,5-dioxo-1-pyrrolidinyl ester; Maleimide-PEG6-NHS ester
CAS Number: 1137109-21-7
Empirical Formula (Hill Notation): C26H39N3O13
Molecular Weight: 601.60
MDL Number: MFCD11041093
Linear Formula: C26H39N3O13
Product Type: Chemical
| form |
liquid |
| functional group |
maleimide |
| |
NHS ester |
| InChI |
1S/C26H39N3O13/c30-21(5-8-28-22(31)1-2-23(28)32)27-7-10-37-12-14-39-16-18-41-20-19-40-17-15-38-13-11-36-9-6-26(35)42-29-24(33)3-4-25(29)34/h1-2H,3-20H2,(H,27,30) |
| InChI key |
AVCPTIUOZBWCKE-UHFFFAOYSA-N |
| reaction suitability |
reaction type: Pegylations |
| |
reagent type: cross-linking reagent |
| SMILES string |
O=C(ON1C(CCC1=O)=O)CCOCCOCCOCCOCCOCCOCCNC(CCN2C(C=CC2=O)=O)=O |
| storage temp. |
−20°C |
| Application: |
Heterobifunctional crosslinker with an ethylene oxide spacer for linking amine- to sulfhydryl-containing compounds or biomolecules. Maleimide functional group will react with sulfhydryls and the succinimidyl ester group will react with amines. Spacer length is 31.7 angstroms. |
| Packaging: |
50, 250 mg in amber glass bottle |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Storage Temp. |
−20°C |
| UNSPSC |
12352108 |
