Synonym: Maleimide PEG12 succinimidyl ester; 2,5-Dioxopyrrolidin-1-yl-1-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)-3-oxo-7,10,13,16,19,22,25,28,31,34,37,40-dodecaoxa-4-azatritetracontan-43-oate; Maleimide-PEG12-NHS este; 2,5-Dioxopyrrolidin-1-yl 1-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)-3-oxo-7,10,13,16,19,22,25,28,31,34,37,40-dodecaoxa-4-azatritetracontan-43-oate; Maleimide-PEG12-NHS ester
CAS Number: 1426151-00-9
Empirical Formula (Hill Notation): C38H63N3O19
Molecular Weight: 865.92
MDL Number: MFCD11041148
Linear Formula: C38H63N3O19
Product Type: Chemical
| form |
liquid |
| InChI |
1S/C38H63N3O19/c42-33(5-8-40-34(43)1-2-35(40)44)39-7-10-49-12-14-51-16-18-53-20-22-55-24-26-57-28-30-59-32-31-58-29-27-56-25-23-54-21-19-52-17-15-50-13-11-48-9-6-38(47)60-41-36(45)3-4-37(41)46/h1-2H,3-32H2,(H,39,42) |
| InChI key |
LWNZLSLPQXOOAO-UHFFFAOYSA-N |
| reaction suitability |
reaction type: Pegylations |
| |
reagent type: cross-linking reagent |
| SMILES string |
O=C(N1CCC(NCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCC(ON(C(CC2)=O)C2=O)=O)=O)C=CC1=O |
| storage temp. |
−20°C |
| Application: |
Heterobifunctional crosslinker with an ethylene oxide spacer for linking amine- to sulfhydryl-containing compounds or biomolecules. Maleimide functional group will react with sulfhydryls and the succinimidyl ester group will react with amines. Spacer length is 53.3 angstroms. |
| Packaging: |
50, 250 mg in amber glass bottle |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Storage Temp. |
−20°C |
| UNSPSC |
12352108 |
