Triethylene glycol dimethacrylate
ALDRICH/759406 - contains 200 ppm monomethyl ether hydroquinone as inhibitor, 99%
CAS Number: 109-16-0
Empirical Formula (Hill Notation): C14H22O6
Molecular Weight: 286.32
EC Number: 203-652-6
MDL Number: MFCD00008591
Linear Formula: CH2=C(CH3)COO(CH2CH2O)3COC(CH3)=CH2
Product Type: Chemical
| assay | 99% |
| bp | 170-172 °C/5 mmHg (lit.) |
| contains | 200 ppm monomethyl ether hydroquinone as inhibitor |
| density | 1.074 g/mL |
| 1.092 g/mL at 25 °C (lit.) | |
| form | liquid |
| InChI | 1S/C14H22O6/c1-11(2)13(15 |
| InChI key | HWSSEYVMGDIFMH-UHFFFAOYSA |
| polymer architecture | shape : linear functionality : homobifunctional |
| Quality Level | 100 ![]() |
| reaction suitability | reagent type: cross-linking reagent reaction type: Polymerization Reactions |
| refractive index | n |
| n |
|
| SMILES string | CC(=C)C(=O)OCCOCCOCCOC(=O |
| storage temp. | 2-8°C |
| Application: | • Used as a diluent comonomer in dimethacrylate based dental composites. • Used as a branching agent in the atom transfer radical polymerization (ATRP) of styrene. |
| Features and Benefits: | Lower viscosity compared to other dimethacrylate monomers enabling higher amounts of filler to be incorporated in dental composites. Non-toxic and can be rapidly polymerized in the presence of oxygen and water. |
| General description: | Triethylene glycol dimethacrylate is used as a cross-linking agent in the synthesis of poly (methacrylic acid-g-ethylene glycol ) hydrogels which shows large changes in swelling due to changes in pH, temperature and solvent composition. They are also used as a divinylic methacrylic monomer which are widely used to form copolymers with divinylbenzene (DVB) and glycidyl methacrylate (GMA) or hydroxyethyl methacrylate (HEMA) comonomers. |
| Packaging: | 1, 10, 50 mL in glass bottle |
| Symbol | GHS07 |
| Signal word | Warning |
| Hazard statements | H317 |
| Precautionary statements | P261 - P272 - P280 - P302 + P352 - P333 + P313 - P362 + P364 |
| Hazard Codes | Xi |
| Risk Statements | 43 |
| Safety Statements | 36/37 |
| RIDADR | UN 3334 |
| WGK Germany | WGK 1 |
| Flash Point(F) | 332.6 °F - closed cup |
| Flash Point(C) | 167 °C - closed cup |
| Purity | 99% |
| bp | 170-172 °C/5 mmHg (lit.) |
| Density | 1.092 g/mL at 25 °C (lit.); 1.074 g/mL |
| Refractive Index | n |
| Storage Temp. | 2-8°C |
| UNSPSC | 12162002 |


