4′-Mercaptobiphenylcarbonitrile
ALDRICH/760080 - 97% (GC)
Synonym: 4′-Mercapto-[1,1′-biphenyl]-4-carbonitrile
CAS Number: 64409-12-7
Empirical Formula (Hill Notation): C13H9NS
Molecular Weight: 211.28
MDL Number: MFCD22417214
Linear Formula: C13H9NS
Product Type: Chemical
| assay | 97% (GC) |
| form | powder |
| InChI | 1S/C13H9NS/c14-9-10-1-3-1 |
| InChI key | ZZSHJNKMDIZSFY-UHFFFAOYSA |
| mp | 127-132 °C |
| Quality Level | 100 ![]() |
| SMILES string | Sc1ccc(cc1)-c2ccc(cc2)C#N |
| Application: | This material is used to tune the electronic properties and subsequent surface coverage of gold surfaces/monolayer. |
| Packaging: | 250 mg in glass insert |
| Symbol | ![]() GHS05,GHS09 |
| Signal word | Danger |
| Hazard statements | H318 - H400 |
| Precautionary statements | P273 - P280 - P305 + P351 + P338 |
| Hazard Codes | Xi,N |
| Risk Statements | 41-50 |
| Safety Statements | 26-39-61 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 97% (GC) |
| mp | 127-132 °C |
| UNSPSC | 12352103 |



