XantPhos-Pd-G2
ALDRICH/763047
Synonym: Chloro[(4,5-
CAS Number: 1375325-77-1
Empirical Formula (Hill Notation): C51H42ClNOP2Pd
Molecular Weight: 888.71
MDL Number: MFCD22666442
Linear Formula: C51H42ClNOP2Pd
Product Type: Chemical
| feature | generation 2 |
| form | solid |
| functional group | phosphine |
| InChI | 1S/C39H32OP2.C12H10N.ClH. |
| InChI key | XVPHXQHDHZRAJL-UHFFFAOYSA |
| mp | 188-196 (decomposition) |
| Quality Level | 100 ![]() |
| reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction |
| reaction type: Heck Reaction | |
| reaction type: Hiyama Coupling | |
| reaction type: Negishi Coupling | |
| reaction type: Sonogashira Coupling | |
| reaction type: Stille Coupling | |
| reaction type: Suzuki-Miyaura Coupling | |
| reagent type: catalyst reaction type: Cross Couplings |
|
| SMILES string | Nc1ccccc1-c2ccccc2[Pd]Cl. |
| Application: | XantPhos-Pd-G2 is a second generation palladium precatalyst with improved reactivity in palladium-catalyzed C-N cross-coupling reactions. |
| Packaging: | 2, 5 g in glass bottle |
| Packaging: | 500 mg in glass bottle |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| mp | 188-196 (decomposition) |
| UNSPSC | 12352300 |

