XantPhos-Pd-G2
ALDRICH/763047
Synonym: Chloro[(4,5-
CAS Number: 1375325-77-1
Empirical Formula (Hill Notation): C51H42ClNOP2Pd
Molecular Weight: 888.71
MDL Number: MFCD22666442
Linear Formula: C51H42ClNOP2Pd
Product Type: Chemical
feature | generation 2 |
form | solid |
functional group | phosphine |
InChI | 1S/C39H32OP2.C12H10N.ClH. |
InChI key | XVPHXQHDHZRAJL-UHFFFAOYSA |
mp | 188-196 (decomposition) |
reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction |
reaction type: Heck Reaction | |
reaction type: Hiyama Coupling | |
reaction type: Negishi Coupling | |
reaction type: Sonogashira Coupling | |
reaction type: Stille Coupling | |
reaction type: Suzuki-Miyaura Coupling | |
reagent type: catalyst reaction type: Cross Couplings |
|
SMILES string | Nc1ccccc1-c2ccccc2[Pd]Cl. |
Application: | XantPhos-Pd-G2 is a second generation palladium precatalyst with improved reactivity in palladium-catalyzed C-N cross-coupling reactions. |
Packaging: | 2, 5 g in glass bottle |
Packaging: | 500 mg in glass bottle |
RIDADR | NONH for all modes of transport |
WGK Germany | WGK 3 |
Flash Point(F) | Not applicable |
Flash Point(C) | Not applicable |
mp | 188-196 (decomposition) |
UNSPSC | 12352300 |