Synonym: 2,5-Dioxopyrrolidin-1-yl 3-(prop-2-ynyloxy)propanoate; 3-(2-Propyn-1-yloxy)propanoic acid 2,5-dioxo-1-pyrrolidinyl ester; Alkyne-NHS ester; Propargyl-succinimidyl-ester
CAS Number: 1174157-65-3
Empirical Formula (Hill Notation): C10H11NO5
Molecular Weight: 225.20
MDL Number: MFCD13184973
Linear Formula: C10H11NO5
Product Type: Chemical
| form |
solid |
| functional group |
alkyne |
| |
NHS ester |
| InChI |
1S/C10H11NO5/c1-2-6-15-7-5-10(14)16-11-8(12)3-4-9(11)13/h1H,3-7H2 |
| InChI key |
WKIKHHMUNOVQLD-UHFFFAOYSA-N |
| mp |
36-41 °C |
| Quality Level |
100  |
| reaction suitability |
reaction type: click chemistry |
| |
reagent type: cross-linking reagent |
| SMILES string |
C#CCOCCC(ON1C(CCC1=O)=O)=O |
| storage temp. |
−20°C |
| Application: |
Propargyl-N-hydroxysuccinimidyl ester may be used as a tool for identifying nucleophilic ligandable hotspots by chemoproteomic approaches. |
| Application: |
Propargyl-NHS ester is an amine reactive reagent for derivatizing peptides, antibodies, amine coated surfaces etc, with a terminal alkyne. The alkyne can be reacted with an azide containing compound or biomolecule via copper catalyzed azide-alkyne click chemistry to yield a stable triazole linkage. |
| Packaging: |
250 mg in amber glass bottle |
| Packaging: |
50 mg in clear glass bottle |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| mp |
36-41 °C |
| Storage Temp. |
−20°C |
| UNSPSC |
12352108 |
