(Acetonitrile)[1,3-bis(2,6-diisopropylphenyl)imidazol-2-ylidene]gold(I) tetrafluoroborate
ALDRICH/766445
Synonym: IPr Au(MeCN)BF4
CAS Number: 1138834-31-7
Empirical Formula (Hill Notation): C29H39AuBF4N3
Molecular Weight: 713.41
MDL Number: MFCD18827652
Linear Formula: C29H39AuBF4N3
Product Type: Chemical
| form | solid |
| impurities | (May contain up to 15% of the chloride salt 696277.) |
| InChI | 1S/C27H36N2.C2H3N.Au.BF4/ |
| InChI key | YZYFYLAQORXITI-UHFFFAOYSA |
| mp | 162-167 °C (decomposition) |
| Quality Level | 100 ![]() |
| reaction suitability | core: gold |
| reagent type: catalyst | |
| SMILES string | CC#N.F[B-](F)(F)F.CC(C)c1 |
| Application: | Useful in the synthesis of pyrroles by amino-Claisen rearrangement |
| Packaging: | 100, 500 mg in glass bottle |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| mp | 162-167 °C (decomposition) |
| UNSPSC | 12161600 |

