Synonym: (SP-4-2)-Dichloro[1,1′-(9,9-dimethyl-9H-xanthene-4,5-diyl)bis[1,1-diphenylphosphine-κP]]-palladium
CAS Number: 205319-10-4
Empirical Formula (Hill Notation): C39H32Cl2OP2Pd
Molecular Weight: 755.94
MDL Number: MFCD14155707
Linear Formula: C39H32Cl2OP2Pd
Product Type: Chemical
| assay |
95% |
| form |
solid |
| InChI |
1S/C39H32OP2.2ClH.Pd/c1-39(2)33-25-15-27-35(41(29-17-7-3-8-18-29)30-19-9-4-10-20-30)37(33)40-38-34(39)26-16-28-36(38)42(31-21-11-5-12-22-31)32-23-13-6-14-24-32;;;/h3-28H,1-2H3;2*1H;/q;;;+2/p-2 |
| InChI key |
HEYONDYPXIUDCK-UHFFFAOYSA-L |
| mp |
280-287 °C (decomposition) |
| Quality Level |
100  |
| reaction suitability |
core: palladium |
| |
reaction type: Buchwald-Hartwig Cross Coupling Reaction |
| |
reaction type: Cross Couplings |
| |
reaction type: Heck Reaction |
| |
reaction type: Hiyama Coupling |
| |
reaction type: Negishi Coupling |
| |
reaction type: Sonogashira Coupling |
| |
reaction type: Stille Coupling |
| |
reaction type: Suzuki-Miyaura Coupling |
| |
reagent type: catalyst |
| SMILES string |
Cl[Pd]Cl.CC1(C)c2cccc(P(c3ccccc3)c4ccccc4)c2Oc5c(cccc15)P(c6ccccc6)c7ccccc7 |
| Application: |
Effective catalyst for carbonylation of aryl halides |
| Packaging: |
2 g in glass bottle |
| Packaging: |
500 mg in glass bottle |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
95% |
| mp |
280-287 °C (decomposition) |
| UNSPSC |
12161600 |
