Resomer® RG 753 H, Poly(D,L-lactide-co-glycolide)
ALDRICH/769819 - acid terminated
Synonym: Resomer® RG 753 H, PLGA
CAS Number: 26780-50-7
MDL Number: MFCD00131930
Linear Formula: HO[C2H4O2]n[C2H2O2]mH
Product Type: Chemical
| feed ratio | lactide:glycolide 75:25 |
| form | amorphous |
| InChI | 1S/C6H8O4.C4H4O4/c1-3-5(7 |
| InChI key | LCSKNASZPVZHEG-UHFFFAOYSA |
| Quality Level | 100 ![]() |
| SMILES string | O2C(C(=O)OC(C2=O)C)C.O1CC |
| storage temp. | 2-8°C |
| transition temp | Tg 44-55 °C |
| viscosity | 0.32-0.44 dL/g |
| Application: | Resomer® RG 753 H, Poly( |
| Legal Information: | RESOMER is a registered trademark of Evonik Rohm GmbH |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Storage Temp. | 2-8°C |
| UNSPSC | 12162002 |

