Ethyl 2-(phenylcarbonothioylthio)-2-phenylacetate
ALDRICH/773506 - 98%
Synonym: α-[(Phenylthioxomethyl)thio]benzeneacetic acid ethyl ester; dithiobenzoate RAFT; Benzodithioate phenyl acetic acid ethyl ester
CAS Number: 1150308-13-6
Empirical Formula (Hill Notation): C17H16O2S2
Molecular Weight: 316.44
MDL Number: MFCD24386381
Linear Formula: C17H16O2S2
Product Type: Chemical
| assay | 98% |
| form | solid |
| InChI | 1S/C17H16O2S2/c1-2-19-16( |
| InChI key | SQKNCNYHCGWDEX-UHFFFAOYSA |
| mp | 48-53 °C |
| Quality Level | 100  |
| SMILES string | CCOC(=O)C(SC(=S)c1ccccc1) |
| storage temp. | 2-8°C |
| Application: | Reversible Addition Fragmentation Chain Transfer (RAFT) Polymerization |
| Application: | This is a RAFT agent for controlled radical polymerization, well-suited for methacrylates and methacrylamides. This is a more temperature stable alternative to Aldrich Prod No. 761257. Chain Transfer Agent (CTA) |
| General description: | Need help choosing the correct RAFT Agent? Please consult the RAFT Agent to Monomer compatibility table . |
| Packaging: | 1 g in glass bottle |
| Symbol |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302 - H410 |
| Precautionary statements | P273 - P301 + P312 + P330 |
| Hazard Codes | Xn,N |
| Risk Statements | 22-50/53 |
| Safety Statements | 60-61 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 98% |
| mp | 48-53 °C |
| Storage Temp. | 2-8°C |
| UNSPSC | 12352100 |