TCO-amine HCl salt
ALDRICH/790451
Synonym: trans-Cyclooctene-amine hydrochloride salt; TCO-NH2, HCl salt
Empirical Formula (Hill Notation): C12H22N2O2 · HCl
Molecular Weight: 262.78
Linear Formula: C12H22N2O2 · HCl
Product Type: Chemical
| form | solid |
| functional group | amine |
| InChI | 1S/C12H22N2O2.ClH/c13-9-6 |
| InChI key | GIYQQURLGCGUKK-TYYBGVCCSA |
| reaction suitability | reaction type: click chemistry |
| reagent type: linker | |
| SMILES string | O=C(NCCCN)OC1CCC/C=C/CC1. |
| storage temp. | −20°C |
| Application: | Amine functionalized trans-cyclooctene derivative for incorporation of the cyclooctene moiety into carboxyl containing compounds or biomolecules via standard coupling techniques (DCC; EDC etc...). Trans-cyclooctenes are useful in strain-promoted copper-free click chemistry cycloaddition reactions with 1; 2; 4; 5-tetrazines. This cyclooctene will react with tetrazine functionalized compounds or biomolecules without the need for a catalyst to result in a stable covalent linkage. The 4+2 inverse electron demand Diels-Alder cycloaddition between trans-cyclooctene and tetrazines is the fastest biologically compatible ligation technology reported and has had many applications in biological labeling and imaging. |
| Packaging: | 10, 50 mg in clear glass bottle |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 46 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Storage Temp. | −20°C |
| UNSPSC | 12352116 |