[(TMEDA)Ni(o-tolyl)Cl]
ALDRICH/804398 - 95%
CAS Number: 1702744-45-3
Empirical Formula (Hill Notation): C13H23ClN2Ni
Molecular Weight: 301.48
MDL Number: MFCD29037017
Linear Formula: C13H23ClN2Ni
Product Type: Chemical
| assay | 95% |
| form | powder |
| InChI | 1S/C7H7.C6H16N2.ClH.Ni/c1 |
| InChI key | NMLMESVZRUMFAE-UHFFFAOYSA |
| Quality Level | 100 ![]() |
| reaction suitability | core: nickel |
| reaction type: Cross Couplings | |
| reagent type: catalyst | |
| SMILES string | CC1=CC=CC=C1[Ni]Cl.CN(C)C |
| Application: | Effective precatalyst for a variety of nickel-catalyzed transformations, including Suzuki-Miyaura, Buchwald-Hartwig and other cyclizations and oxidative couplings. |
| Packaging: | 100 mg in glass bottle |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 95% |
| UNSPSC | 12161600 |

