Vitamin D3-23,24,25,26,27-13C5 solution
ALDRICH/809772 - 1 mg/mL in ethanol, ≥98 atom % 13C, ≥97% (CP)
Empirical Formula (Hill Notation): 13C5C22H44O
Molecular Weight: 389.60
Linear Formula: 13C5C22H44O
Product Type: Chemical
| assay | ≥97% (CP) |
| color | colorless |
| concentration | 1 mg/mL in ethanol |
| form | liquid |
| InChI | 1S/C27H44O/c1-19(2)8-6-9- |
| InChI key | QYSXJUFSXHHAJI-FIVBZVICSA |
| isotopic purity | ≥98 atom % 13C |
| mass shift | M+5 |
| Quality Level | 200 ![]() |
| SMILES string | C=C1CC[C@H](O)C/C1=C/C=C2 |
| storage temp. | −20°C |
| technique(s) | mass spectrometry (MS): suitable |
| Application: | Vitamin D3-23,24,25,26,27-13C5 can be used as an analytical standard for data interpretation in specific biological samples. |
| General description: | Vitamin D3, also known as cholecalciferol, promotes the absorption of calcium and phosphorus in the body to regulate bone growth. Vitamin D3 is most commonly found in humans and animals and is produced in our skin when exposed to sunlight. It is used to treat and prevent bone disorders (such as rickets, osteomalacia). Vitamin D3-23,24,25,26,27-13C5 is an isotope of vitamin D3 wherein C-23, C-24, C-25, C-26, C-27 carbons are replaced by 13C6 isotope. |
| Symbol | ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225 - H319 |
| Precautionary statements | P210 - P233 - P240 - P241 - P242 - P305 + P351 + P338 |
| RIDADR | UN1170 - class 3 - PG 2 - Ethanol, solution |
| WGK Germany | WGK 1 |
| Flash Point(F) | 57.2 °F |
| Flash Point(C) | 14 °C |
| Purity | ≥97% (CP) |
| Storage Temp. | −20°C |
| UNSPSC | 12352005 |



