tert-Butyl 12-amino-4,7,10-trioxadodecanoate
ALDRICH/83060 - technical, ≥80% (T)
Synonym: Amino-PEG3-tert-butyl ester; tert-Butyl 3-
CAS Number: 252881-74-6
Empirical Formula (Hill Notation): C13H27NO5
Molecular Weight: 277.36
MDL Number: MFCD06201017
Linear Formula: C13H27NO5
Product Type: Chemical
| assay | ≥80% (T) |
| form | solid |
| grade | technical |
| InChI | 1S/C13H27NO5/c1-13(2,3)19 |
| InChI key | CWFSAZJIJBTKRC-UHFFFAOYSA |
| Quality Level | 100  |
| reaction suitability | reagent type: cross-linking reagent |
| SMILES string | CC(C)(C)OC(=O)CCOCCOCCOCC |
| storage temp. | −20°C |
| Application: | tert-Butyl 12-amino-4,7,10-trioxadod • Synthesis of the tetanus-toxin conjugate of MUC1 glycopeptide antigen, as a potential antitumor vaccine. • Synthesis of self-assembled monolayer-based surface-enhanced raman scattering (SERS) labels for immuno-SERS microscopy. • Synthesis of polycationic adamantane-based dendrons for cell imaging. • Synthesis of phthalocyanine (Pc)-peptide conjugates as potential fluorescence imaging agents for cancers overexpressing epidermal growth factor receptors (EGFR). |
| Other Notes: | Intermediate in the synthesis of a spacer for combinatorial chemistry |
| Packaging: | 1, 5 g in glass bottle |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315 - H319 - H335 |
| Precautionary statements | P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | 337.5 °F |
| Flash Point(C) | 169.7 °C |
| Purity | ≥80% (T) |
| Storage Temp. | −20°C |
| UNSPSC | 12352200 |