Bis(2-ethylhexyl) sebacate
ALDRICH/84822 - ≥97.0% (GC)
Synonym: Di(2-ethylhexyl) sebacate; Sebacic acid di(2-ethylhexyl) ester; ‘Dioctyl’ sebacate
CAS Number: 122-62-3
Empirical Formula (Hill Notation): C26H50O4
Molecular Weight: 426.67
EC Number: 204-558-8
MDL Number: MFCD00009497
Linear Formula: [-(CH2)4CO2CH2CH(C2H5)(CH2)3CH3]2
Product Type: Chemical
| assay | ≥97.0% (GC) |
| bp | 212 °C/1 mmHg (lit.) |
| density | 0.914 g/mL at 25 °C (lit.) |
| form | liquid |
| InChI | 1S/C26H50O4/c1-5-9-17-23( |
| InChI key | VJHINFRRDQUWOJ-UHFFFAOYSA |
| refractive index | n |
| SMILES string | CCCCC(CC)COC(=O)CCCCCCCCC |
| Application: | Bis(2-ethylhexyl) sebacate is commonly used as a pressure transmitting fluid (PTF) in hydraulically operated devices, pressure measuring instruments and hydraulic pressure balances. It is also a plasticizing solvent mediator for preparing poly(vinyl chloride) (PVC) based membranes. |
| Packaging: | 1 L in glass bottle |
| Packaging: | 250 mL in glass bottle |
| RIDADR | NONH for all modes of transport |
| WGK Germany | awg |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥97.0% (GC) |
| bp | 212 °C/1 mmHg (lit.) |
| Density | 0.914 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| UNSPSC | 12352100 |